C19H20O8 — CID 19075817
bis[(4-methoxyphenyl)methyl] 2,2-dihydroxypropanedioate (PubChem CID 19075817) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is bis[(4-methoxyphenyl)methyl] 2,2-dihydroxypropanedioate.
| Compound Name | bis[(4-methoxyphenyl)methyl] 2,2-dihydroxypropanedioate |
|---|---|
| PubChem CID | 19075817 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | bis[(4-methoxyphenyl)methyl] 2,2-dihydroxypropanedioate |
| SMILES | COc1ccc(COC(=O)C(O)(O)C(=O)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H20O8/c1-24-15-7-3-13(4-8-15)11-26-17(20)19(22,23)18(21)27-12-14-5-9-16(25-2)10-6-14/h3-10,22-23H,11-12H2,1-2H3 |
| InChIKey | JTFORBKWSLFAPK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|