About (4-methoxyphenyl)methyl silylformate
(4-methoxyphenyl)methyl silylformate (PubChem CID 123289214) has the molecular formula C9H12O3Si
and a molecular weight of 196.28 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl silylformate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl silylformate |
| PubChem CID | 123289214 |
| Molecular Formula | C9H12O3Si |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (4-methoxyphenyl)methyl silylformate |
| SMILES | COc1ccc(COC(=O)[SiH3])cc1 |
| InChI | InChI=1S/C9H12O3Si/c1-11-8-4-2-7(3-5-8)6-12-9(10)13/h2-5H,6H2,1,13H3 |
| InChIKey | DOHDLYRFEWDCTJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methyl silylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl silylformate?
The IUPAC name of (4-methoxyphenyl)methyl silylformate (CID 123289214) is (4-methoxyphenyl)methyl silylformate.
What is the SMILES notation for (4-methoxyphenyl)methyl silylformate?
The canonical SMILES for (4-methoxyphenyl)methyl silylformate is COc1ccc(COC(=O)[SiH3])cc1.
What is the InChIKey of (4-methoxyphenyl)methyl silylformate?
The InChIKey is DOHDLYRFEWDCTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3Si/c1-11-8-4-2-7(3-5-8)6-12-9(10)13/h2-5H,6H2,1,13H3.
What are the key properties of (4-methoxyphenyl)methyl silylformate?
(4-methoxyphenyl)methyl silylformate has a molecular weight of 196.28 g/mol, XLogP of 0.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl silylformate is sourced from PubChem (CID 123289214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).