C10H10F2O3S — CID 163433987
(4-methoxyphenyl)methyl 2,2-difluoro-2-sulfanylacetate (PubChem CID 163433987) has the molecular formula C10H10F2O3S and a molecular weight of 248.25 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2,2-difluoro-2-sulfanylacetate.
| Compound Name | (4-methoxyphenyl)methyl 2,2-difluoro-2-sulfanylacetate |
|---|---|
| PubChem CID | 163433987 |
| Molecular Formula | C10H10F2O3S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (4-methoxyphenyl)methyl 2,2-difluoro-2-sulfanylacetate |
| SMILES | COc1ccc(COC(=O)C(F)(F)S)cc1 |
| InChI | InChI=1S/C10H10F2O3S/c1-14-8-4-2-7(3-5-8)6-15-9(13)10(11,12)16/h2-5,16H,6H2,1H3 |
| InChIKey | ASXDCISOCNJEPZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|