C14H18O3 — CID 56995818
(4-methoxyphenyl)methyl 3-cyclopropylpropanoate (PubChem CID 56995818) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-cyclopropylpropanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 56995818 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-cyclopropylpropanoate |
| SMILES | COc1ccc(COC(=O)CCC2CC2)cc1 |
| InChI | InChI=1S/C14H18O3/c1-16-13-7-4-12(5-8-13)10-17-14(15)9-6-11-2-3-11/h4-5,7-8,11H,2-3,6,9-10H2,1H3 |
| InChIKey | RGEUBIICDUJCGS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |