C12H13NO4 — CID 70319681
(4-methoxyphenyl)methyl (2S)-4-oxoazetidine-2-carboxylate (PubChem CID 70319681) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S)-4-oxoazetidine-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 70319681 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S)-4-oxoazetidine-2-carboxylate |
| SMILES | COc1ccc(COC(=O)[C@@H]2CC(=O)N2)cc1 |
| InChI | InChI=1S/C12H13NO4/c1-16-9-4-2-8(3-5-9)7-17-12(15)10-6-11(14)13-10/h2-5,10H,6-7H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | ZSWAWTVOHGGXGV-JTQLQIEISA-N |
| XLogP | 0.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |