C16H20O5 — CID 88671607
(4-methoxyphenyl)methyl 4-formyloxycyclohexane-1-carboxylate (PubChem CID 88671607) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-formyloxycyclohexane-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 4-formyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88671607 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-formyloxycyclohexane-1-carboxylate |
| SMILES | COc1ccc(COC(=O)C2CCC(OC=O)CC2)cc1 |
| InChI | InChI=1S/C16H20O5/c1-19-14-6-2-12(3-7-14)10-20-16(18)13-4-8-15(9-5-13)21-11-17/h2-3,6-7,11,13,15H,4-5,8-10H2,1H3 |
| InChIKey | GEWOEGXZWHKKEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|