About (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate
(4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate (PubChem CID 141135197) has the molecular formula C13H14O5
and a molecular weight of 250.25 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate |
| PubChem CID | 141135197 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate |
| SMILES | COc1ccc(COC(=O)C2CCOC2=O)cc1 |
| InChI | InChI=1S/C13H14O5/c1-16-10-4-2-9(3-5-10)8-18-13(15)11-6-7-17-12(11)14/h2-5,11H,6-8H2,1H3 |
| InChIKey | GXBALBZJOWYTPM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate?
The IUPAC name of (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate (CID 141135197) is (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate.
What is the SMILES notation for (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate?
The canonical SMILES for (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate is COc1ccc(COC(=O)C2CCOC2=O)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate?
The InChIKey is GXBALBZJOWYTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5/c1-16-10-4-2-9(3-5-10)8-18-13(15)11-6-7-17-12(11)14/h2-5,11H,6-8H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate?
(4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate has a molecular weight of 250.25 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 2-oxooxolane-3-carboxylate is sourced from PubChem (CID 141135197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).