C17H20O3 — CID 146030054
(4-methoxyphenyl)methyl (2S,3R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 146030054) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,3R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,3R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 146030054 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,3R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)[C@@H]2C3C=CC(C3)[C@H]2C)cc1 |
| InChI | InChI=1S/C17H20O3/c1-11-13-5-6-14(9-13)16(11)17(18)20-10-12-3-7-15(19-2)8-4-12/h3-8,11,13-14,16H,9-10H2,1-2H3/t11-,13?,14?,16+/m1/s1 |
| InChIKey | UNQCAXZDDPGZFF-QCTRAFQOSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|