C43H46O8 — CID 102001339
bis[4-[4-(4-methoxyphenyl)phenoxy]butyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 102001339) has the molecular formula C43H46O8 and a molecular weight of 690.83 g/mol. Its IUPAC name is bis[4-[4-(4-methoxyphenyl)phenoxy]butyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[4-[4-(4-methoxyphenyl)phenoxy]butyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102001339 |
| Molecular Formula | C43H46O8 |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | bis[4-[4-(4-methoxyphenyl)phenoxy]butyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COc1ccc(-c2ccc(OCCCCOC(=O)[C@H]3[C@H](C(=O)OCCCCOc4ccc(-c5ccc(OC)cc5)cc4)[C@H]4C=C[C@@H]3C4)cc2)cc1 |
| InChI | InChI=1S/C43H46O8/c1-46-36-17-9-30(10-18-36)32-13-21-38(22-14-32)48-25-3-5-27-50-42(44)40-34-7-8-35(29-34)41(40)43(45)51-28-6-4-26-49-39-23-15-33(16-24-39)31-11-19-37(47-2)20-12-31/h7-24,34-35,40-41H,3-6,25-29H2,1-2H3/t34-,35+,40-,41-/m1/s1 |
| InChIKey | GVBYLMYFXNYIRX-KIJKQVFNSA-N |
| XLogP | 8.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|