C39H32N2O6 — CID 11828288
bis[2-[4-(4-cyanophenyl)phenoxy]ethyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 11828288) has the molecular formula C39H32N2O6 and a molecular weight of 624.69 g/mol. Its IUPAC name is bis[2-[4-(4-cyanophenyl)phenoxy]ethyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[2-[4-(4-cyanophenyl)phenoxy]ethyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11828288 |
| Molecular Formula | C39H32N2O6 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | bis[2-[4-(4-cyanophenyl)phenoxy]ethyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | N#Cc1ccc(-c2ccc(OCCOC(=O)[C@H]3[C@H](C(=O)OCCOc4ccc(-c5ccc(C#N)cc5)cc4)[C@H]4C=C[C@@H]3C4)cc2)cc1 |
| InChI | InChI=1S/C39H32N2O6/c40-24-26-1-5-28(6-2-26)30-11-15-34(16-12-30)44-19-21-46-38(42)36-32-9-10-33(23-32)37(36)39(43)47-22-20-45-35-17-13-31(14-18-35)29-7-3-27(25-41)4-8-29/h1-18,32-33,36-37H,19-23H2/t32-,33+,36-,37-/m1/s1 |
| InChIKey | LZLYYVMTRJQNBI-LXUJUZKLSA-N |
| XLogP | 6.75 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|