C19H17NO5 — CID 18326855
2-[3-[4-(4-cyanophenyl)phenoxy]propyl]propanedioic acid (PubChem CID 18326855) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3-[4-(4-cyanophenyl)phenoxy]propyl]propanedioic acid.
| Compound Name | 2-[3-[4-(4-cyanophenyl)phenoxy]propyl]propanedioic acid |
|---|---|
| PubChem CID | 18326855 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3-[4-(4-cyanophenyl)phenoxy]propyl]propanedioic acid |
| SMILES | N#Cc1ccc(-c2ccc(OCCCC(C(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H17NO5/c20-12-13-3-5-14(6-4-13)15-7-9-16(10-8-15)25-11-1-2-17(18(21)22)19(23)24/h3-10,17H,1-2,11H2,(H,21,22)(H,23,24) |
| InChIKey | LJNRUAREZKYAOC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|