C22H24N2O5S — CID 41151127
2-(4-cyanophenoxy)ethyl 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 41151127) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 41151127 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)OCCOc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-17-2-8-21(9-3-17)30(26,27)24-12-10-19(11-13-24)22(25)29-15-14-28-20-6-4-18(16-23)5-7-20/h2-9,19H,10-15H2,1H3 |
| InChIKey | WTSNETHWZSRJDW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|