C23H24N2O6S — CID 41214249
2-(4-cyanophenoxy)ethyl (2R)-1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 41214249) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl (2R)-1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl (2R)-1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 41214249 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl (2R)-1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)OCCOc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-17(26)19-7-11-21(12-8-19)32(28,29)25-13-3-2-4-22(25)23(27)31-15-14-30-20-9-5-18(16-24)6-10-20/h5-12,22H,2-4,13-15H2,1H3/t22-/m1/s1 |
| InChIKey | MLIXTCNONLHAPV-JOCHJYFZSA-N |
| XLogP | 2.93 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|