C22H28N2O6S — CID 55310683
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 55310683) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 55310683 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)C1CCCCN1S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H28N2O6S/c1-4-13-23(14-5-2)21(26)16-30-22(27)20-8-6-7-15-24(20)31(28,29)19-11-9-18(10-12-19)17(3)25/h4-5,9-12,20H,1-2,6-8,13-16H2,3H3 |
| InChIKey | BRSDCGMAXHJTDB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|