C24H28N2O6S — CID 42978014
[2-(3-ethylanilino)-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 42978014) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 42978014 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCc1cccc(NC(=O)COC(=O)C2CCCCN2S(=O)(=O)c2ccc(C(C)=O)cc2)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-3-18-7-6-8-20(15-18)25-23(28)16-32-24(29)22-9-4-5-14-26(22)33(30,31)21-12-10-19(11-13-21)17(2)27/h6-8,10-13,15,22H,3-5,9,14,16H2,1-2H3,(H,25,28) |
| InChIKey | WTRPVOQOJQOWAB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |