C24H28N2O5S — CID 30066412
2-(4-cyanophenoxy)ethyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 30066412) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 30066412 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)OCCOc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-18(2)20-5-9-23(10-6-20)32(28,29)26-13-11-21(12-14-26)24(27)31-16-15-30-22-7-3-19(17-25)4-8-22/h3-10,18,21H,11-16H2,1-2H3 |
| InChIKey | UPZUQDXKWIJMEX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|