C23H29NO6S — CID 42979943
2-(4-methoxyphenyl)ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 42979943) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 42979943 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)OCCc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H29NO6S/c1-3-29-21-8-10-22(11-9-21)31(26,27)24-15-12-19(13-16-24)23(25)30-17-14-18-4-6-20(28-2)7-5-18/h4-11,19H,3,12-17H2,1-2H3 |
| InChIKey | ZXQFDJKXUONDEK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |