C20H29N3O6S — CID 1075480
ethyl 4-[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 1075480) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is ethyl 4-[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1075480 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl 4-[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H29N3O6S/c1-3-29-20(25)22-14-12-21(13-15-22)19(24)16-8-10-23(11-9-16)30(26,27)18-6-4-17(28-2)5-7-18/h4-7,16H,3,8-15H2,1-2H3 |
| InChIKey | KMGNBHXLKZZTKE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |