C18H24N2O6S — CID 41049470
[2-(cyclopropylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 41049470) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 41049470 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)OCC(=O)NC3CC3)CC2)cc1 |
| InChI | InChI=1S/C18H24N2O6S/c1-25-15-4-6-16(7-5-15)27(23,24)20-10-8-13(9-11-20)18(22)26-12-17(21)19-14-2-3-14/h4-7,13-14H,2-3,8-12H2,1H3,(H,19,21) |
| InChIKey | ANLONWJTGJNDPU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |