C16H21N3O7S — CID 46659229
[2-(carbamoylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 46659229) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 46659229 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)OCC(=O)NC(N)=O)C2)cc1 |
| InChI | InChI=1S/C16H21N3O7S/c1-25-12-4-6-13(7-5-12)27(23,24)19-8-2-3-11(9-19)15(21)26-10-14(20)18-16(17)22/h4-7,11H,2-3,8-10H2,1H3,(H3,17,18,20,22) |
| InChIKey | ICAWVNJEVTURJC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |