C21H25NO5S2 — CID 46659336
(4-methylsulfanylphenyl)methyl 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 46659336) has the molecular formula C21H25NO5S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (4-methylsulfanylphenyl)methyl 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 46659336 |
| Molecular Formula | C21H25NO5S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)OCc3ccc(SC)cc3)C2)cc1 |
| InChI | InChI=1S/C21H25NO5S2/c1-26-18-7-11-20(12-8-18)29(24,25)22-13-3-4-17(14-22)21(23)27-15-16-5-9-19(28-2)10-6-16/h5-12,17H,3-4,13-15H2,1-2H3 |
| InChIKey | ZUPNQFIURSAIQK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |