C20H22FNO5S — CID 55414190
(3-methoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55414190) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55414190 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (3-methoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1cccc(COC(=O)C2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C20H22FNO5S/c1-26-18-6-2-4-15(12-18)14-27-20(23)16-5-3-11-22(13-16)28(24,25)19-9-7-17(21)8-10-19/h2,4,6-10,12,16H,3,5,11,13-14H2,1H3 |
| InChIKey | IJPYWMZMOBEZNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |