C19H17F4NO4S — CID 166181785
[3-(trifluoromethyl)phenyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 166181785) has the molecular formula C19H17F4NO4S and a molecular weight of 431.41 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 166181785 |
| Molecular Formula | C19H17F4NO4S |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(Oc1cccc(C(F)(F)F)c1)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H17F4NO4S/c20-15-6-8-17(9-7-15)29(26,27)24-10-2-3-13(12-24)18(25)28-16-5-1-4-14(11-16)19(21,22)23/h1,4-9,11,13H,2-3,10,12H2 |
| InChIKey | ANDDOZGLZPTDEG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|