C18H24FNO4S — CID 18226686
cyclohexyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 18226686) has the molecular formula C18H24FNO4S and a molecular weight of 369.46 g/mol. Its IUPAC name is cyclohexyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | cyclohexyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 18226686 |
| Molecular Formula | C18H24FNO4S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | cyclohexyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(OC1CCCCC1)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H24FNO4S/c19-15-8-10-17(11-9-15)25(22,23)20-12-4-5-14(13-20)18(21)24-16-6-2-1-3-7-16/h8-11,14,16H,1-7,12-13H2 |
| InChIKey | GPWSSWVUTFHNRR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |