C20H19ClFNO5S — CID 55427695
[2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55427695) has the molecular formula C20H19ClFNO5S and a molecular weight of 439.89 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55427695 |
| Molecular Formula | C20H19ClFNO5S |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClFNO5S/c21-16-5-3-14(4-6-16)19(24)13-28-20(25)15-2-1-11-23(12-15)29(26,27)18-9-7-17(22)8-10-18/h3-10,15H,1-2,11-13H2 |
| InChIKey | GBMNLOHQZIAKSU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |