C19H19BrN2O5S — CID 55828087
(3-carbamoylphenyl) 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55828087) has the molecular formula C19H19BrN2O5S and a molecular weight of 467.34 g/mol. Its IUPAC name is (3-carbamoylphenyl) 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3-carbamoylphenyl) 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55828087 |
| Molecular Formula | C19H19BrN2O5S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | (3-carbamoylphenyl) 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)c1 |
| InChI | InChI=1S/C19H19BrN2O5S/c20-15-6-8-17(9-7-15)28(25,26)22-10-2-4-14(12-22)19(24)27-16-5-1-3-13(11-16)18(21)23/h1,3,5-9,11,14H,2,4,10,12H2,(H2,21,23) |
| InChIKey | WOQNLYAVQGCUGG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|