C20H23FN2O5S — CID 3746097
N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 3746097) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3746097 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H23FN2O5S/c1-27-16-7-10-18(19(12-16)28-2)22-20(24)14-4-3-11-23(13-14)29(25,26)17-8-5-15(21)6-9-17/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | VIFRRCAFYKTZIW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |