C20H23BrN2O5S — CID 55906809
N-(5-bromo-2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 55906809) has the molecular formula C20H23BrN2O5S and a molecular weight of 483.38 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55906809 |
| Molecular Formula | C20H23BrN2O5S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)Nc3cc(Br)ccc3OC)C2)cc1 |
| InChI | InChI=1S/C20H23BrN2O5S/c1-27-16-6-8-17(9-7-16)29(25,26)23-11-3-4-14(13-23)20(24)22-18-12-15(21)5-10-19(18)28-2/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | OAEYXGDMFPCHBP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |