C19H28N2O5S — CID 87924630
(cyclohexylamino) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 87924630) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is (cyclohexylamino) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (cyclohexylamino) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 87924630 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (cyclohexylamino) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)ONC3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-25-17-9-11-18(12-10-17)27(23,24)21-13-5-6-15(14-21)19(22)26-20-16-7-3-2-4-8-16/h9-12,15-16,20H,2-8,13-14H2,1H3 |
| InChIKey | GOHISDLVCDUTIR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|