C22H25NO7S — CID 31154587
[2-(2-methoxyphenyl)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 31154587) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 31154587 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)OCC(=O)c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H25NO7S/c1-28-17-7-9-18(10-8-17)31(26,27)23-13-11-16(12-14-23)22(25)30-15-20(24)19-5-3-4-6-21(19)29-2/h3-10,16H,11-15H2,1-2H3 |
| InChIKey | ITCDGTJSQYRUEK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |