C23H25NO5 — CID 7739829
[2-(2-methoxyphenyl)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate (PubChem CID 7739829) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7739829 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
| SMILES | COc1ccccc1C(=O)COC(=O)C1CCN(C(=O)c2ccccc2C)CC1 |
| InChI | InChI=1S/C23H25NO5/c1-16-7-3-4-8-18(16)22(26)24-13-11-17(12-14-24)23(27)29-15-20(25)19-9-5-6-10-21(19)28-2/h3-10,17H,11-15H2,1-2H3 |
| InChIKey | TZUAGMFOOICDQJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |