C23H25N3O5 — CID 7739967
[2-(4-carbamoylanilino)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate (PubChem CID 7739967) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7739967 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)OCC(=O)Nc2ccc(C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C23H25N3O5/c1-15-4-2-3-5-19(15)22(29)26-12-10-17(11-13-26)23(30)31-14-20(27)25-18-8-6-16(7-9-18)21(24)28/h2-9,17H,10-14H2,1H3,(H2,24,28)(H,25,27) |
| InChIKey | VNOXIVHAOOAYBR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |