C22H22ClFN2O4 — CID 18272318
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 18272318) has the molecular formula C22H22ClFN2O4 and a molecular weight of 432.88 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18272318 |
| Molecular Formula | C22H22ClFN2O4 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H22ClFN2O4/c1-14-2-7-18(12-19(14)24)25-20(27)13-30-22(29)16-8-10-26(11-9-16)21(28)15-3-5-17(23)6-4-15/h2-7,12,16H,8-11,13H2,1H3,(H,25,27) |
| InChIKey | ALFNVFBBIJCMNT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |