C18H21ClN2O4 — CID 8635164
[2-(cyclopropylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 8635164) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8635164 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1)NC1CC1 |
| InChI | InChI=1S/C18H21ClN2O4/c19-14-3-1-12(2-4-14)17(23)21-9-7-13(8-10-21)18(24)25-11-16(22)20-15-5-6-15/h1-4,13,15H,5-11H2,(H,20,22) |
| InChIKey | AFGDILGAEACSBZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |