C22H29ClN2O4 — CID 3376009
[2-(cycloheptylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 3376009) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3376009 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1)NC1CCCCCC1 |
| InChI | InChI=1S/C22H29ClN2O4/c23-18-9-7-16(8-10-18)21(27)25-13-11-17(12-14-25)22(28)29-15-20(26)24-19-5-3-1-2-4-6-19/h7-10,17,19H,1-6,11-15H2,(H,24,26) |
| InChIKey | ZGWDOTRYLRMKBK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |