C24H22FNO5S — CID 1158068
[2-(4-fluorophenyl)-2-oxoethyl] 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 1158068) has the molecular formula C24H22FNO5S and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 1158068 |
| Molecular Formula | C24H22FNO5S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FNO5S/c25-21-8-5-18(6-9-21)23(27)16-31-24(28)19-11-13-26(14-12-19)32(29,30)22-10-7-17-3-1-2-4-20(17)15-22/h1-10,15,19H,11-14,16H2 |
| InChIKey | SZXBKPLXMWETCT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |