C20H28N2O7S2 — CID 55404012
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 1-ethylsulfonylpiperidine-4-carboxylate (PubChem CID 55404012) has the molecular formula C20H28N2O7S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 1-ethylsulfonylpiperidine-4-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 1-ethylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55404012 |
| Molecular Formula | C20H28N2O7S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 1-ethylsulfonylpiperidine-4-carboxylate |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)OCC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H28N2O7S2/c1-2-30(25,26)21-13-9-17(10-14-21)20(24)29-15-19(23)16-5-7-18(8-6-16)31(27,28)22-11-3-4-12-22/h5-8,17H,2-4,9-15H2,1H3 |
| InChIKey | NLOYPPDDVALNTF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |