C20H30N2O6S2 — CID 1167102
ethyl 1-[4-(azepan-1-ylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 1167102) has the molecular formula C20H30N2O6S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 1-[4-(azepan-1-ylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(azepan-1-ylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 1167102 |
| Molecular Formula | C20H30N2O6S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 1-[4-(azepan-1-ylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H30N2O6S2/c1-2-28-20(23)17-11-15-22(16-12-17)30(26,27)19-9-7-18(8-10-19)29(24,25)21-13-5-3-4-6-14-21/h7-10,17H,2-6,11-16H2,1H3 |
| InChIKey | GUYALNLNSKUBBB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |