C13H17ClN2O4S — CID 822460
ethyl 1-[(6-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate (PubChem CID 822460) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is ethyl 1-[(6-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(6-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 822460 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | ethyl 1-[(6-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-2-20-13(17)10-5-7-16(8-6-10)21(18,19)11-3-4-12(14)15-9-11/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | RVWRVVJZXSWDBY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|