C11H16ClN3O3S — CID 163464809
(3R)-1-[(6-chloro-3-pyridinyl)sulfonyl]pyrrolidine-3-carboxamide;methane (PubChem CID 163464809) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is (3R)-1-[(6-chloro-3-pyridinyl)sulfonyl]pyrrolidine-3-carboxamide;methane.
| Compound Name | (3R)-1-[(6-chloro-3-pyridinyl)sulfonyl]pyrrolidine-3-carboxamide;methane |
|---|---|
| PubChem CID | 163464809 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (3R)-1-[(6-chloro-3-pyridinyl)sulfonyl]pyrrolidine-3-carboxamide;methane |
| SMILES | C.NC(=O)[C@@H]1CCN(S(=O)(=O)c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C10H12ClN3O3S.CH4/c11-9-2-1-8(5-13-9)18(16,17)14-4-3-7(6-14)10(12)15;/h1-2,5,7H,3-4,6H2,(H2,12,15);1H4/t7-;/m1./s1 |
| InChIKey | BRPYPQHGLDPOFX-OGFXRTJISA-N |
| XLogP | 0.87 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|