C11H13IN2O3S — CID 164885708
1-(4-iodophenyl)sulfonylpyrrolidine-3-carboxamide (PubChem CID 164885708) has the molecular formula C11H13IN2O3S and a molecular weight of 380.21 g/mol. Its IUPAC name is 1-(4-iodophenyl)sulfonylpyrrolidine-3-carboxamide.
| Compound Name | 1-(4-iodophenyl)sulfonylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 164885708 |
| Molecular Formula | C11H13IN2O3S |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 1-(4-iodophenyl)sulfonylpyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C11H13IN2O3S/c12-9-1-3-10(4-2-9)18(16,17)14-6-5-8(7-14)11(13)15/h1-4,8H,5-7H2,(H2,13,15) |
| InChIKey | ZBPLBCQDDDZZBH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|