C13H18N2O5S2 — CID 31534108
1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 31534108) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 31534108 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C13H18N2O5S2/c1-21(17,18)11-2-4-12(5-3-11)22(19,20)15-8-6-10(7-9-15)13(14)16/h2-5,10H,6-9H2,1H3,(H2,14,16) |
| InChIKey | HFZPTVNKXADANI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |