C17H26N2O3S — CID 3559679
1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 3559679) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3559679 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C)c1C |
| InChI | InChI=1S/C17H26N2O3S/c1-10-11(2)13(4)16(14(5)12(10)3)23(21,22)19-8-6-15(7-9-19)17(18)20/h15H,6-9H2,1-5H3,(H2,18,20) |
| InChIKey | JYKROOUOMCOBNB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |