C12H17N3O5S2 — CID 3137783
1-(4-sulfamoylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 3137783) has the molecular formula C12H17N3O5S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(4-sulfamoylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3137783 |
| Molecular Formula | C12H17N3O5S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(4-sulfamoylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C12H17N3O5S2/c13-12(16)9-5-7-15(8-6-9)22(19,20)11-3-1-10(2-4-11)21(14,17)18/h1-4,9H,5-8H2,(H2,13,16)(H2,14,17,18) |
| InChIKey | KKDRZWHKDLGOLG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |