C14H17N3O4S2 — CID 22550008
1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxamide (PubChem CID 22550008) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22550008 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)CS3)CC1 |
| InChI | InChI=1S/C14H17N3O4S2/c15-14(19)9-3-5-17(6-4-9)23(20,21)10-1-2-12-11(7-10)16-13(18)8-22-12/h1-2,7,9H,3-6,8H2,(H2,15,19)(H,16,18) |
| InChIKey | WOYVMZBUYVLMKD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |