C16H22N2O3S2 — CID 22550000
N-cyclooctyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 22550000) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-cyclooctyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-cyclooctyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22550000 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-cyclooctyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1CSc2ccc(S(=O)(=O)NC3CCCCCCC3)cc2N1 |
| InChI | InChI=1S/C16H22N2O3S2/c19-16-11-22-15-9-8-13(10-14(15)17-16)23(20,21)18-12-6-4-2-1-3-5-7-12/h8-10,12,18H,1-7,11H2,(H,17,19) |
| InChIKey | JJNLRMDOQZNDQQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |