C11H9N3O3S3 — CID 110759474
3-oxo-N-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 110759474) has the molecular formula C11H9N3O3S3 and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-oxo-N-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 110759474 |
| Molecular Formula | C11H9N3O3S3 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 3-oxo-N-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1CSc2ccc(S(=O)(=O)Nc3nccs3)cc2N1 |
| InChI | InChI=1S/C11H9N3O3S3/c15-10-6-19-9-2-1-7(5-8(9)13-10)20(16,17)14-11-12-3-4-18-11/h1-5H,6H2,(H,12,14)(H,13,15) |
| InChIKey | ZKWSNJMEBYKSKB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |