C15H16N2O3S3 — CID 22550073
3-oxo-N-(1-thiophen-2-ylpropyl)-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 22550073) has the molecular formula C15H16N2O3S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is 3-oxo-N-(1-thiophen-2-ylpropyl)-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(1-thiophen-2-ylpropyl)-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22550073 |
| Molecular Formula | C15H16N2O3S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 3-oxo-N-(1-thiophen-2-ylpropyl)-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc2c(c1)NC(=O)CS2)c1cccs1 |
| InChI | InChI=1S/C15H16N2O3S3/c1-2-11(13-4-3-7-21-13)17-23(19,20)10-5-6-14-12(8-10)16-15(18)9-22-14/h3-8,11,17H,2,9H2,1H3,(H,16,18) |
| InChIKey | DUXZOCQHQKANON-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |