C15H14N2O3S2 — CID 22550066
N-benzyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 22550066) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-benzyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-benzyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22550066 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-benzyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1CSc2ccc(S(=O)(=O)NCc3ccccc3)cc2N1 |
| InChI | InChI=1S/C15H14N2O3S2/c18-15-10-21-14-7-6-12(8-13(14)17-15)22(19,20)16-9-11-4-2-1-3-5-11/h1-8,16H,9-10H2,(H,17,18) |
| InChIKey | DWFNPBBZGJKHHK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |