C14H11FN2O3S2 — CID 110759476
N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 110759476) has the molecular formula C14H11FN2O3S2 and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 110759476 |
| Molecular Formula | C14H11FN2O3S2 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1CSc2ccc(S(=O)(=O)Nc3cccc(F)c3)cc2N1 |
| InChI | InChI=1S/C14H11FN2O3S2/c15-9-2-1-3-10(6-9)17-22(19,20)11-4-5-13-12(7-11)16-14(18)8-21-13/h1-7,17H,8H2,(H,16,18) |
| InChIKey | NCMCAQILKGQEFJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |